About 1-(2-chloro-5-ethylsulfanylphenyl)-3-(3-ethylphenyl)-1,3-dimethylguanidine
1-(2-chloro-5-ethylsulfanylphenyl)-3-(3-ethylphenyl)-1,3-dimethylguanidine (PubChem CID 18751658) has the molecular formula C19H24ClN3S
and a molecular weight of 361.94 g/mol. Its IUPAC name is 1-(2-chloro-5-ethylsulfanylphenyl)-3-(3-ethylphenyl)-1,3-dimethylguanidine.
Molecular Properties
| Compound Name | 1-(2-chloro-5-ethylsulfanylphenyl)-3-(3-ethylphenyl)-1,3-dimethylguanidine |
| PubChem CID | 18751658 |
| Molecular Formula | C19H24ClN3S |
| Molecular Weight | 361.94 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 1-(2-chloro-5-ethylsulfanylphenyl)-3-(3-ethylphenyl)-1,3-dimethylguanidine |
| SMILES | [H]/N=C(\N(C)c1cccc(CC)c1)N(C)c1cc(SCC)ccc1Cl |
| InChI | InChI=1S/C19H24ClN3S/c1-5-14-8-7-9-15(12-14)22(3)19(21)23(4)18-13-16(24-6-2)10-11-17(18)20/h7-13,21H,5-6H2,1-4H3/b21-19+ |
| InChIKey | UXEINQWCFTVESK-XUTLUUPISA-N |
| XLogP | 5.52 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.94 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chloro-5-ethylsulfanylphenyl)-3-(3-ethylphenyl)-1,3-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloro-5-ethylsulfanylphenyl)-3-(3-ethylphenyl)-1,3-dimethylguanidine?
The IUPAC name of 1-(2-chloro-5-ethylsulfanylphenyl)-3-(3-ethylphenyl)-1,3-dimethylguanidine (CID 18751658) is 1-(2-chloro-5-ethylsulfanylphenyl)-3-(3-ethylphenyl)-1,3-dimethylguanidine.
What is the SMILES notation for 1-(2-chloro-5-ethylsulfanylphenyl)-3-(3-ethylphenyl)-1,3-dimethylguanidine?
The canonical SMILES for 1-(2-chloro-5-ethylsulfanylphenyl)-3-(3-ethylphenyl)-1,3-dimethylguanidine is [H]/N=C(\N(C)c1cccc(CC)c1)N(C)c1cc(SCC)ccc1Cl.
What is the InChIKey of 1-(2-chloro-5-ethylsulfanylphenyl)-3-(3-ethylphenyl)-1,3-dimethylguanidine?
The InChIKey is UXEINQWCFTVESK-XUTLUUPISA-N. The full InChI is InChI=1S/C19H24ClN3S/c1-5-14-8-7-9-15(12-14)22(3)19(21)23(4)18-13-16(24-6-2)10-11-17(18)20/h7-13,21H,5-6H2,1-4H3/b21-19+.
What are the key properties of 1-(2-chloro-5-ethylsulfanylphenyl)-3-(3-ethylphenyl)-1,3-dimethylguanidine?
1-(2-chloro-5-ethylsulfanylphenyl)-3-(3-ethylphenyl)-1,3-dimethylguanidine has a molecular weight of 361.94 g/mol, XLogP of 5.52, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloro-5-ethylsulfanylphenyl)-3-(3-ethylphenyl)-1,3-dimethylguanidine is sourced from PubChem (CID 18751658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).