C19H25BrClN3S — CID 45265207
2-(2-bromo-5-ethyl-3-methylsulfanylphenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride (PubChem CID 45265207) has the molecular formula C19H25BrClN3S and a molecular weight of 442.85 g/mol. Its IUPAC name is 2-(2-bromo-5-ethyl-3-methylsulfanylphenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride.
| Compound Name | 2-(2-bromo-5-ethyl-3-methylsulfanylphenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride |
|---|---|
| PubChem CID | 45265207 |
| Molecular Formula | C19H25BrClN3S |
| Molecular Weight | 442.85 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 2-(2-bromo-5-ethyl-3-methylsulfanylphenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride |
| SMILES | CCc1cccc(N(C)/C(N)=N/c2cc(CC)cc(SC)c2Br)c1.Cl |
| InChI | InChI=1S/C19H24BrN3S.ClH/c1-5-13-8-7-9-15(10-13)23(3)19(21)22-16-11-14(6-2)12-17(24-4)18(16)20;/h7-12H,5-6H2,1-4H3,(H2,21,22);1H |
| InChIKey | SBAFPYCCHUMXKU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.85 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|