C19H20ClN3O2 — CID 21191524
1-(3-ethylphenyl)-1-methyl-2-(2-oxochromen-8-yl)guanidine;hydrochloride (PubChem CID 21191524) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-1-methyl-2-(2-oxochromen-8-yl)guanidine;hydrochloride.
| Compound Name | 1-(3-ethylphenyl)-1-methyl-2-(2-oxochromen-8-yl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 21191524 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 1-(3-ethylphenyl)-1-methyl-2-(2-oxochromen-8-yl)guanidine;hydrochloride |
| SMILES | CCc1cccc(N(C)/C(N)=N/c2cccc3ccc(=O)oc23)c1.Cl |
| InChI | InChI=1S/C19H19N3O2.ClH/c1-3-13-6-4-8-15(12-13)22(2)19(20)21-16-9-5-7-14-10-11-17(23)24-18(14)16;/h4-12H,3H2,1-2H3,(H2,20,21);1H |
| InChIKey | GRWZFZPZOAKPON-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 71.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|