C20H22ClN3 — CID 22121805
1-(2,5-dimethylphenyl)-1-methyl-2-naphthalen-1-ylguanidine;hydrochloride (PubChem CID 22121805) has the molecular formula C20H22ClN3 and a molecular weight of 339.87 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-1-methyl-2-naphthalen-1-ylguanidine;hydrochloride.
| Compound Name | 1-(2,5-dimethylphenyl)-1-methyl-2-naphthalen-1-ylguanidine;hydrochloride |
|---|---|
| PubChem CID | 22121805 |
| Molecular Formula | C20H22ClN3 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-1-methyl-2-naphthalen-1-ylguanidine;hydrochloride |
| SMILES | Cc1ccc(C)c(N(C)/C(N)=N/c2cccc3ccccc23)c1.Cl |
| InChI | InChI=1S/C20H21N3.ClH/c1-14-11-12-15(2)19(13-14)23(3)20(21)22-18-10-6-8-16-7-4-5-9-17(16)18;/h4-13H,1-3H3,(H2,21,22);1H |
| InChIKey | GHBHFKFLIXTKIL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|