About 2-(trifluoromethyl)benzene-1,4-diamine;5-(trifluoromethyl)benzene-1,3-diamine
2-(trifluoromethyl)benzene-1,4-diamine;5-(trifluoromethyl)benzene-1,3-diamine (PubChem CID 89251950) has the molecular formula C14H14F6N4
and a molecular weight of 352.28 g/mol. Its IUPAC name is 2-(trifluoromethyl)benzene-1,4-diamine;5-(trifluoromethyl)benzene-1,3-diamine.
Molecular Properties
| Compound Name | 2-(trifluoromethyl)benzene-1,4-diamine;5-(trifluoromethyl)benzene-1,3-diamine |
| PubChem CID | 89251950 |
| Molecular Formula | C14H14F6N4 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-(trifluoromethyl)benzene-1,4-diamine;5-(trifluoromethyl)benzene-1,3-diamine |
| SMILES | Nc1cc(N)cc(C(F)(F)F)c1.Nc1ccc(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/2C7H7F3N2/c8-7(9,10)4-1-5(11)3-6(12)2-4;8-7(9,10)5-3-4(11)1-2-6(5)12/h2*1-3H,11-12H2 |
| InChIKey | BYRUHMNVNDQQAR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(trifluoromethyl)benzene-1,4-diamine;5-(trifluoromethyl)benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethyl)benzene-1,4-diamine;5-(trifluoromethyl)benzene-1,3-diamine?
The IUPAC name of 2-(trifluoromethyl)benzene-1,4-diamine;5-(trifluoromethyl)benzene-1,3-diamine (CID 89251950) is 2-(trifluoromethyl)benzene-1,4-diamine;5-(trifluoromethyl)benzene-1,3-diamine.
What is the SMILES notation for 2-(trifluoromethyl)benzene-1,4-diamine;5-(trifluoromethyl)benzene-1,3-diamine?
The canonical SMILES for 2-(trifluoromethyl)benzene-1,4-diamine;5-(trifluoromethyl)benzene-1,3-diamine is Nc1cc(N)cc(C(F)(F)F)c1.Nc1ccc(N)c(C(F)(F)F)c1.
What is the InChIKey of 2-(trifluoromethyl)benzene-1,4-diamine;5-(trifluoromethyl)benzene-1,3-diamine?
The InChIKey is BYRUHMNVNDQQAR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H7F3N2/c8-7(9,10)4-1-5(11)3-6(12)2-4;8-7(9,10)5-3-4(11)1-2-6(5)12/h2*1-3H,11-12H2.
What are the key properties of 2-(trifluoromethyl)benzene-1,4-diamine;5-(trifluoromethyl)benzene-1,3-diamine?
2-(trifluoromethyl)benzene-1,4-diamine;5-(trifluoromethyl)benzene-1,3-diamine has a molecular weight of 352.28 g/mol, XLogP of 3.74, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethyl)benzene-1,4-diamine;5-(trifluoromethyl)benzene-1,3-diamine is sourced from PubChem (CID 89251950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).