C14H14F6N4 — CID 89251950
2-(trifluoromethyl)benzene-1,4-diamine;5-(trifluoromethyl)benzene-1,3-diamine (PubChem CID 89251950) has the molecular formula C14H14F6N4 and a molecular weight of 352.28 g/mol. Its IUPAC name is 2-(trifluoromethyl)benzene-1,4-diamine;5-(trifluoromethyl)benzene-1,3-diamine.
| Compound Name | 2-(trifluoromethyl)benzene-1,4-diamine;5-(trifluoromethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 89251950 |
| Molecular Formula | C14H14F6N4 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-(trifluoromethyl)benzene-1,4-diamine;5-(trifluoromethyl)benzene-1,3-diamine |
| SMILES | Nc1cc(N)cc(C(F)(F)F)c1.Nc1ccc(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/2C7H7F3N2/c8-7(9,10)4-1-5(11)3-6(12)2-4;8-7(9,10)5-3-4(11)1-2-6(5)12/h2*1-3H,11-12H2 |
| InChIKey | BYRUHMNVNDQQAR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|