C16H10F6N4O — CID 167165237
4-[5-[4-amino-3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]-2-(trifluoromethyl)aniline (PubChem CID 167165237) has the molecular formula C16H10F6N4O and a molecular weight of 388.27 g/mol. Its IUPAC name is 4-[5-[4-amino-3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]-2-(trifluoromethyl)aniline.
| Compound Name | 4-[5-[4-amino-3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 167165237 |
| Molecular Formula | C16H10F6N4O |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 4-[5-[4-amino-3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]-2-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(-c2nnc(-c3ccc(N)c(C(F)(F)F)c3)o2)cc1C(F)(F)F |
| InChI | InChI=1S/C16H10F6N4O/c17-15(18,19)9-5-7(1-3-11(9)23)13-25-26-14(27-13)8-2-4-12(24)10(6-8)16(20,21)22/h1-6H,23-24H2 |
| InChIKey | PPVYFLLSROXCRK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|