C27H19F6N3O — CID 171073522
4-[8-[4-amino-3-(trifluoromethyl)phenyl]-10-methylphenoxazin-2-yl]-2-(trifluoromethyl)aniline (PubChem CID 171073522) has the molecular formula C27H19F6N3O and a molecular weight of 515.46 g/mol. Its IUPAC name is 4-[8-[4-amino-3-(trifluoromethyl)phenyl]-10-methylphenoxazin-2-yl]-2-(trifluoromethyl)aniline.
| Compound Name | 4-[8-[4-amino-3-(trifluoromethyl)phenyl]-10-methylphenoxazin-2-yl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 171073522 |
| Molecular Formula | C27H19F6N3O |
| Molecular Weight | 515.46 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 4-[8-[4-amino-3-(trifluoromethyl)phenyl]-10-methylphenoxazin-2-yl]-2-(trifluoromethyl)aniline |
| SMILES | CN1c2cc(-c3ccc(N)c(C(F)(F)F)c3)ccc2Oc2ccc(-c3ccc(N)c(C(F)(F)F)c3)cc21 |
| InChI | InChI=1S/C27H19F6N3O/c1-36-22-12-16(14-2-6-20(34)18(10-14)26(28,29)30)4-8-24(22)37-25-9-5-17(13-23(25)36)15-3-7-21(35)19(11-15)27(31,32)33/h2-13H,34-35H2,1H3 |
| InChIKey | FYIRWKREKSXLOE-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.46 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|