C32H26F6N2O4 — CID 174288599
4-[8-[4-hydroxy-3-(trifluoromethyl)phenyl]-10-(2-morpholin-4-ylethyl)phenoxazin-2-yl]-2-(trifluoromethyl)phenol (PubChem CID 174288599) has the molecular formula C32H26F6N2O4 and a molecular weight of 616.56 g/mol. Its IUPAC name is 4-[8-[4-hydroxy-3-(trifluoromethyl)phenyl]-10-(2-morpholin-4-ylethyl)phenoxazin-2-yl]-2-(trifluoromethyl)phenol.
| Compound Name | 4-[8-[4-hydroxy-3-(trifluoromethyl)phenyl]-10-(2-morpholin-4-ylethyl)phenoxazin-2-yl]-2-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 174288599 |
| Molecular Formula | C32H26F6N2O4 |
| Molecular Weight | 616.56 g/mol |
| Exact Mass | 616.18 |
| IUPAC Name | 4-[8-[4-hydroxy-3-(trifluoromethyl)phenyl]-10-(2-morpholin-4-ylethyl)phenoxazin-2-yl]-2-(trifluoromethyl)phenol |
| SMILES | Oc1ccc(-c2ccc3c(c2)N(CCN2CCOCC2)c2cc(-c4ccc(O)c(C(F)(F)F)c4)ccc2O3)cc1C(F)(F)F |
| InChI | InChI=1S/C32H26F6N2O4/c33-31(34,35)23-15-19(1-5-27(23)41)21-3-7-29-25(17-21)40(10-9-39-11-13-43-14-12-39)26-18-22(4-8-30(26)44-29)20-2-6-28(42)24(16-20)32(36,37)38/h1-8,15-18,41-42H,9-14H2 |
| InChIKey | MTKOVJKHEZCIBB-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.56 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'} |
|---|