C36H30F6N2O6 — CID 177251588
2,2,2-trifluoroethyl 3-[7-(4-methoxycarbonylphenyl)-10-(2-morpholin-4-ylethyl)-8-(trifluoromethyl)phenoxazin-3-yl]benzoate (PubChem CID 177251588) has the molecular formula C36H30F6N2O6 and a molecular weight of 700.63 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 3-[7-(4-methoxycarbonylphenyl)-10-(2-morpholin-4-ylethyl)-8-(trifluoromethyl)phenoxazin-3-yl]benzoate.
| Compound Name | 2,2,2-trifluoroethyl 3-[7-(4-methoxycarbonylphenyl)-10-(2-morpholin-4-ylethyl)-8-(trifluoromethyl)phenoxazin-3-yl]benzoate |
|---|---|
| PubChem CID | 177251588 |
| Molecular Formula | C36H30F6N2O6 |
| Molecular Weight | 700.63 g/mol |
| Exact Mass | 700.20 |
| IUPAC Name | 2,2,2-trifluoroethyl 3-[7-(4-methoxycarbonylphenyl)-10-(2-morpholin-4-ylethyl)-8-(trifluoromethyl)phenoxazin-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cc3c(cc2C(F)(F)F)N(CCN2CCOCC2)c2ccc(-c4cccc(C(=O)OCC(F)(F)F)c4)cc2O3)cc1 |
| InChI | InChI=1S/C36H30F6N2O6/c1-47-33(45)23-7-5-22(6-8-23)27-19-32-30(20-28(27)36(40,41)42)44(12-11-43-13-15-48-16-14-43)29-10-9-25(18-31(29)50-32)24-3-2-4-26(17-24)34(46)49-21-35(37,38)39/h2-10,17-20H,11-16,21H2,1H3 |
| InChIKey | CIVHWFGAWIYKSM-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.63 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'} |
|---|