C34H28F3N3O4 — CID 171073620
4-[7-(1H-indol-5-yl)-10-(2-morpholin-4-ylethyl)phenoxazin-3-yl]-2-(trifluoromethyl)benzoic acid (PubChem CID 171073620) has the molecular formula C34H28F3N3O4 and a molecular weight of 599.61 g/mol. Its IUPAC name is 4-[7-(1H-indol-5-yl)-10-(2-morpholin-4-ylethyl)phenoxazin-3-yl]-2-(trifluoromethyl)benzoic acid.
| Compound Name | 4-[7-(1H-indol-5-yl)-10-(2-morpholin-4-ylethyl)phenoxazin-3-yl]-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 171073620 |
| Molecular Formula | C34H28F3N3O4 |
| Molecular Weight | 599.61 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | 4-[7-(1H-indol-5-yl)-10-(2-morpholin-4-ylethyl)phenoxazin-3-yl]-2-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc3c(c2)Oc2cc(-c4ccc5[nH]ccc5c4)ccc2N3CCN2CCOCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C34H28F3N3O4/c35-34(36,37)27-18-22(1-5-26(27)33(41)42)24-4-8-30-32(20-24)44-31-19-23(21-2-6-28-25(17-21)9-10-38-28)3-7-29(31)40(30)12-11-39-13-15-43-16-14-39/h1-10,17-20,38H,11-16H2,(H,41,42) |
| InChIKey | XYGHZWSPHYNFEI-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.61 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'} |
|---|