C32H29N3O3 — CID 122688624
2-(1H-indol-6-yl)-3-[2-[1-(3-morpholin-4-ylpropyl)indol-6-yl]ethynyl]benzoic acid (PubChem CID 122688624) has the molecular formula C32H29N3O3 and a molecular weight of 503.60 g/mol. Its IUPAC name is 2-(1H-indol-6-yl)-3-[2-[1-(3-morpholin-4-ylpropyl)indol-6-yl]ethynyl]benzoic acid.
| Compound Name | 2-(1H-indol-6-yl)-3-[2-[1-(3-morpholin-4-ylpropyl)indol-6-yl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 122688624 |
| Molecular Formula | C32H29N3O3 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 2-(1H-indol-6-yl)-3-[2-[1-(3-morpholin-4-ylpropyl)indol-6-yl]ethynyl]benzoic acid |
| SMILES | O=C(O)c1cccc(C#Cc2ccc3ccn(CCCN4CCOCC4)c3c2)c1-c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C32H29N3O3/c36-32(37)28-4-1-3-26(31(28)27-10-9-24-11-13-33-29(24)22-27)8-6-23-5-7-25-12-16-35(30(25)21-23)15-2-14-34-17-19-38-20-18-34/h1,3-5,7,9-13,16,21-22,33H,2,14-15,17-20H2,(H,36,37) |
| InChIKey | CDLXQLQDCNIHAU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 70.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|