C31H25FN2O3 — CID 122688531
3-[2-[7-fluoro-1-(oxan-4-ylmethyl)indol-6-yl]ethynyl]-2-(1H-indol-6-yl)benzoic acid (PubChem CID 122688531) has the molecular formula C31H25FN2O3 and a molecular weight of 492.55 g/mol. Its IUPAC name is 3-[2-[7-fluoro-1-(oxan-4-ylmethyl)indol-6-yl]ethynyl]-2-(1H-indol-6-yl)benzoic acid.
| Compound Name | 3-[2-[7-fluoro-1-(oxan-4-ylmethyl)indol-6-yl]ethynyl]-2-(1H-indol-6-yl)benzoic acid |
|---|---|
| PubChem CID | 122688531 |
| Molecular Formula | C31H25FN2O3 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 3-[2-[7-fluoro-1-(oxan-4-ylmethyl)indol-6-yl]ethynyl]-2-(1H-indol-6-yl)benzoic acid |
| SMILES | O=C(O)c1cccc(C#Cc2ccc3ccn(CC4CCOCC4)c3c2F)c1-c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C31H25FN2O3/c32-29-23(7-8-24-11-15-34(30(24)29)19-20-12-16-37-17-13-20)6-5-22-2-1-3-26(31(35)36)28(22)25-9-4-21-10-14-33-27(21)18-25/h1-4,7-11,14-15,18,20,33H,12-13,16-17,19H2,(H,35,36) |
| InChIKey | HQKRTZZXCIYQDQ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|