C31H25FN2O3S — CID 166656746
3-[2-[7-fluoro-1-[(1-oxothian-4-yl)methyl]indol-6-yl]ethynyl]-2-(1H-indol-6-yl)benzoic acid (PubChem CID 166656746) has the molecular formula C31H25FN2O3S and a molecular weight of 524.62 g/mol. Its IUPAC name is 3-[2-[7-fluoro-1-[(1-oxothian-4-yl)methyl]indol-6-yl]ethynyl]-2-(1H-indol-6-yl)benzoic acid.
| Compound Name | 3-[2-[7-fluoro-1-[(1-oxothian-4-yl)methyl]indol-6-yl]ethynyl]-2-(1H-indol-6-yl)benzoic acid |
|---|---|
| PubChem CID | 166656746 |
| Molecular Formula | C31H25FN2O3S |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 3-[2-[7-fluoro-1-[(1-oxothian-4-yl)methyl]indol-6-yl]ethynyl]-2-(1H-indol-6-yl)benzoic acid |
| SMILES | O=C(O)c1cccc(C#Cc2ccc3ccn(CC4CCS(=O)CC4)c3c2F)c1-c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C31H25FN2O3S/c32-29-23(7-8-24-11-15-34(30(24)29)19-20-12-16-38(37)17-13-20)6-5-22-2-1-3-26(31(35)36)28(22)25-9-4-21-10-14-33-27(21)18-25/h1-4,7-11,14-15,18,20,33H,12-13,16-17,19H2,(H,35,36) |
| InChIKey | SURUOJMBSCWXSF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|