C30H25N3O2S — CID 166656761
2-(1H-indol-6-yl)-3-[2-[2-(thiomorpholin-4-ylmethyl)-1H-indol-6-yl]ethynyl]benzoic acid (PubChem CID 166656761) has the molecular formula C30H25N3O2S and a molecular weight of 491.62 g/mol. Its IUPAC name is 2-(1H-indol-6-yl)-3-[2-[2-(thiomorpholin-4-ylmethyl)-1H-indol-6-yl]ethynyl]benzoic acid.
| Compound Name | 2-(1H-indol-6-yl)-3-[2-[2-(thiomorpholin-4-ylmethyl)-1H-indol-6-yl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 166656761 |
| Molecular Formula | C30H25N3O2S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 2-(1H-indol-6-yl)-3-[2-[2-(thiomorpholin-4-ylmethyl)-1H-indol-6-yl]ethynyl]benzoic acid |
| SMILES | O=C(O)c1cccc(C#Cc2ccc3cc(CN4CCSCC4)[nH]c3c2)c1-c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C30H25N3O2S/c34-30(35)26-3-1-2-22(29(26)24-9-8-21-10-11-31-27(21)18-24)6-4-20-5-7-23-17-25(32-28(23)16-20)19-33-12-14-36-15-13-33/h1-3,5,7-11,16-18,31-32H,12-15,19H2,(H,34,35) |
| InChIKey | DMLIBFDEHVQESB-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 72.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|