C34H29N3O4S — CID 122688784
3-[2-[4-[benzenesulfonyl(piperazin-1-yl)methyl]phenyl]ethynyl]-2-(1H-indol-6-yl)benzoic acid (PubChem CID 122688784) has the molecular formula C34H29N3O4S and a molecular weight of 575.69 g/mol. Its IUPAC name is 3-[2-[4-[benzenesulfonyl(piperazin-1-yl)methyl]phenyl]ethynyl]-2-(1H-indol-6-yl)benzoic acid.
| Compound Name | 3-[2-[4-[benzenesulfonyl(piperazin-1-yl)methyl]phenyl]ethynyl]-2-(1H-indol-6-yl)benzoic acid |
|---|---|
| PubChem CID | 122688784 |
| Molecular Formula | C34H29N3O4S |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | 3-[2-[4-[benzenesulfonyl(piperazin-1-yl)methyl]phenyl]ethynyl]-2-(1H-indol-6-yl)benzoic acid |
| SMILES | O=C(O)c1cccc(C#Cc2ccc(C(N3CCNCC3)S(=O)(=O)c3ccccc3)cc2)c1-c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C34H29N3O4S/c38-34(39)30-8-4-5-26(32(30)28-16-15-25-17-18-36-31(25)23-28)12-9-24-10-13-27(14-11-24)33(37-21-19-35-20-22-37)42(40,41)29-6-2-1-3-7-29/h1-8,10-11,13-18,23,33,35-36H,19-22H2,(H,38,39) |
| InChIKey | YZFVROSSCQAMFM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|