C26H21NO3 — CID 122688551
3-[2-[4-(2-hydroxypropan-2-yl)phenyl]ethynyl]-2-(1H-indol-6-yl)benzoic acid (PubChem CID 122688551) has the molecular formula C26H21NO3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-[2-[4-(2-hydroxypropan-2-yl)phenyl]ethynyl]-2-(1H-indol-6-yl)benzoic acid.
| Compound Name | 3-[2-[4-(2-hydroxypropan-2-yl)phenyl]ethynyl]-2-(1H-indol-6-yl)benzoic acid |
|---|---|
| PubChem CID | 122688551 |
| Molecular Formula | C26H21NO3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 3-[2-[4-(2-hydroxypropan-2-yl)phenyl]ethynyl]-2-(1H-indol-6-yl)benzoic acid |
| SMILES | CC(C)(O)c1ccc(C#Cc2cccc(C(=O)O)c2-c2ccc3cc[nH]c3c2)cc1 |
| InChI | InChI=1S/C26H21NO3/c1-26(2,30)21-12-7-17(8-13-21)6-9-19-4-3-5-22(25(28)29)24(19)20-11-10-18-14-15-27-23(18)16-20/h3-5,7-8,10-16,27,30H,1-2H3,(H,28,29) |
| InChIKey | CHEGYYFVXNSVQV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|