C30H24N2O4 — CID 122688603
2-(1H-indol-6-yl)-3-[2-[4-[(4-oxocyclohexyl)carbamoyl]phenyl]ethynyl]benzoic acid (PubChem CID 122688603) has the molecular formula C30H24N2O4 and a molecular weight of 476.53 g/mol. Its IUPAC name is 2-(1H-indol-6-yl)-3-[2-[4-[(4-oxocyclohexyl)carbamoyl]phenyl]ethynyl]benzoic acid.
| Compound Name | 2-(1H-indol-6-yl)-3-[2-[4-[(4-oxocyclohexyl)carbamoyl]phenyl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 122688603 |
| Molecular Formula | C30H24N2O4 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 2-(1H-indol-6-yl)-3-[2-[4-[(4-oxocyclohexyl)carbamoyl]phenyl]ethynyl]benzoic acid |
| SMILES | O=C1CCC(NC(=O)c2ccc(C#Cc3cccc(C(=O)O)c3-c3ccc4cc[nH]c4c3)cc2)CC1 |
| InChI | InChI=1S/C30H24N2O4/c33-25-14-12-24(13-15-25)32-29(34)22-8-5-19(6-9-22)4-7-21-2-1-3-26(30(35)36)28(21)23-11-10-20-16-17-31-27(20)18-23/h1-3,5-6,8-11,16-18,24,31H,12-15H2,(H,32,34)(H,35,36) |
| InChIKey | GAUDGJJJFSPNSM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|