C31H20N2O3 — CID 122688466
3-[2-[4-[(2-cyanophenoxy)methyl]phenyl]ethynyl]-2-(1H-indol-6-yl)benzoic acid (PubChem CID 122688466) has the molecular formula C31H20N2O3 and a molecular weight of 468.51 g/mol. Its IUPAC name is 3-[2-[4-[(2-cyanophenoxy)methyl]phenyl]ethynyl]-2-(1H-indol-6-yl)benzoic acid.
| Compound Name | 3-[2-[4-[(2-cyanophenoxy)methyl]phenyl]ethynyl]-2-(1H-indol-6-yl)benzoic acid |
|---|---|
| PubChem CID | 122688466 |
| Molecular Formula | C31H20N2O3 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 3-[2-[4-[(2-cyanophenoxy)methyl]phenyl]ethynyl]-2-(1H-indol-6-yl)benzoic acid |
| SMILES | N#Cc1ccccc1OCc1ccc(C#Cc2cccc(C(=O)O)c2-c2ccc3cc[nH]c3c2)cc1 |
| InChI | InChI=1S/C31H20N2O3/c32-19-26-4-1-2-7-29(26)36-20-22-10-8-21(9-11-22)12-13-24-5-3-6-27(31(34)35)30(24)25-15-14-23-16-17-33-28(23)18-25/h1-11,14-18,33H,20H2,(H,34,35) |
| InChIKey | UTJWKUPHNOINDU-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|