C36H34N4OS — CID 171073806
4-[2-[3,7-bis(3-methyl-1H-indol-5-yl)phenothiazin-10-yl]ethyl]morpholine (PubChem CID 171073806) has the molecular formula C36H34N4OS and a molecular weight of 570.76 g/mol. Its IUPAC name is 4-[2-[3,7-bis(3-methyl-1H-indol-5-yl)phenothiazin-10-yl]ethyl]morpholine.
| Compound Name | 4-[2-[3,7-bis(3-methyl-1H-indol-5-yl)phenothiazin-10-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 171073806 |
| Molecular Formula | C36H34N4OS |
| Molecular Weight | 570.76 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 4-[2-[3,7-bis(3-methyl-1H-indol-5-yl)phenothiazin-10-yl]ethyl]morpholine |
| SMILES | Cc1c[nH]c2ccc(-c3ccc4c(c3)Sc3cc(-c5ccc6[nH]cc(C)c6c5)ccc3N4CCN3CCOCC3)cc12 |
| InChI | InChI=1S/C36H34N4OS/c1-23-21-37-31-7-3-25(17-29(23)31)27-5-9-33-35(19-27)42-36-20-28(26-4-8-32-30(18-26)24(2)22-38-32)6-10-34(36)40(33)12-11-39-13-15-41-16-14-39/h3-10,17-22,37-38H,11-16H2,1-2H3 |
| InChIKey | VDGHMDYYYSUPHV-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.76 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |