C32H28N6OS — CID 171073413
4-[2-[3,7-bis(1H-indazol-6-yl)phenothiazin-10-yl]ethyl]morpholine (PubChem CID 171073413) has the molecular formula C32H28N6OS and a molecular weight of 544.68 g/mol. Its IUPAC name is 4-[2-[3,7-bis(1H-indazol-6-yl)phenothiazin-10-yl]ethyl]morpholine.
| Compound Name | 4-[2-[3,7-bis(1H-indazol-6-yl)phenothiazin-10-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 171073413 |
| Molecular Formula | C32H28N6OS |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | 4-[2-[3,7-bis(1H-indazol-6-yl)phenothiazin-10-yl]ethyl]morpholine |
| SMILES | c1cc2c(cc1-c1ccc3cn[nH]c3c1)Sc1cc(-c3ccc4cn[nH]c4c3)ccc1N2CCN1CCOCC1 |
| InChI | InChI=1S/C32H28N6OS/c1-3-25-19-33-35-27(25)15-21(1)23-5-7-29-31(17-23)40-32-18-24(22-2-4-26-20-34-36-28(26)16-22)6-8-30(32)38(29)10-9-37-11-13-39-14-12-37/h1-8,15-20H,9-14H2,(H,33,35)(H,34,36) |
| InChIKey | WHERCVSEKPPHKN-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |