C24H22N6O — CID 172717006
6-(1H-indazol-6-yl)-N-(4-morpholin-4-ylphenyl)imidazo[1,2-a]pyridin-8-amine (PubChem CID 172717006) has the molecular formula C24H22N6O and a molecular weight of 410.48 g/mol. Its IUPAC name is 6-(1H-indazol-6-yl)-N-(4-morpholin-4-ylphenyl)imidazo[1,2-a]pyridin-8-amine.
| Compound Name | 6-(1H-indazol-6-yl)-N-(4-morpholin-4-ylphenyl)imidazo[1,2-a]pyridin-8-amine |
|---|---|
| PubChem CID | 172717006 |
| Molecular Formula | C24H22N6O |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 6-(1H-indazol-6-yl)-N-(4-morpholin-4-ylphenyl)imidazo[1,2-a]pyridin-8-amine |
| SMILES | c1cn2cc(-c3ccc4cn[nH]c4c3)cc(Nc3ccc(N4CCOCC4)cc3)c2n1 |
| InChI | InChI=1S/C24H22N6O/c1-2-18-15-26-28-22(18)13-17(1)19-14-23(24-25-7-8-30(24)16-19)27-20-3-5-21(6-4-20)29-9-11-31-12-10-29/h1-8,13-16,27H,9-12H2,(H,26,28) |
| InChIKey | FZNQZVHIIBNWEC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|