C26H27N7O — CID 59473092
2-[1-[4-[[6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]piperidin-4-yl]ethanol (PubChem CID 59473092) has the molecular formula C26H27N7O and a molecular weight of 453.55 g/mol. Its IUPAC name is 2-[1-[4-[[6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]piperidin-4-yl]ethanol.
| Compound Name | 2-[1-[4-[[6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]piperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 59473092 |
| Molecular Formula | C26H27N7O |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 2-[1-[4-[[6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]piperidin-4-yl]ethanol |
| SMILES | OCCC1CCN(c2ccc(Nc3nc(-c4ccc5cn[nH]c5c4)cn4ccnc34)cc2)CC1 |
| InChI | InChI=1S/C26H27N7O/c34-14-9-18-7-11-32(12-8-18)22-5-3-21(4-6-22)29-25-26-27-10-13-33(26)17-24(30-25)19-1-2-20-16-28-31-23(20)15-19/h1-6,10,13,15-18,34H,7-9,11-12,14H2,(H,28,31)(H,29,30) |
| InChIKey | ZEZIRBUTVZWDNZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 94.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|