C24H23N7O — CID 59473243
(3R)-1-[4-[[6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]-3-methylpyrrolidin-3-ol (PubChem CID 59473243) has the molecular formula C24H23N7O and a molecular weight of 425.50 g/mol. Its IUPAC name is (3R)-1-[4-[[6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]-3-methylpyrrolidin-3-ol.
| Compound Name | (3R)-1-[4-[[6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]-3-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 59473243 |
| Molecular Formula | C24H23N7O |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (3R)-1-[4-[[6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]-3-methylpyrrolidin-3-ol |
| SMILES | C[C@@]1(O)CCN(c2ccc(Nc3nc(-c4ccc5cn[nH]c5c4)cn4ccnc34)cc2)C1 |
| InChI | InChI=1S/C24H23N7O/c1-24(32)8-10-31(15-24)19-6-4-18(5-7-19)27-22-23-25-9-11-30(23)14-21(28-22)16-2-3-17-13-26-29-20(17)12-16/h2-7,9,11-14,32H,8,10,15H2,1H3,(H,26,29)(H,27,28)/t24-/m1/s1 |
| InChIKey | PQBYMEWLYFLTEV-XMMPIXPASA-N |
| XLogP | 3.98 |
| TPSA | 94.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|