C34H26F6N2O6 — CID 171073816
4-[8-[4-carboxy-3-(trifluoromethyl)phenyl]-10-(2-morpholin-4-ylethyl)phenoxazin-2-yl]-2-(trifluoromethyl)benzoic acid (PubChem CID 171073816) has the molecular formula C34H26F6N2O6 and a molecular weight of 672.58 g/mol. Its IUPAC name is 4-[8-[4-carboxy-3-(trifluoromethyl)phenyl]-10-(2-morpholin-4-ylethyl)phenoxazin-2-yl]-2-(trifluoromethyl)benzoic acid.
| Compound Name | 4-[8-[4-carboxy-3-(trifluoromethyl)phenyl]-10-(2-morpholin-4-ylethyl)phenoxazin-2-yl]-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 171073816 |
| Molecular Formula | C34H26F6N2O6 |
| Molecular Weight | 672.58 g/mol |
| Exact Mass | 672.17 |
| IUPAC Name | 4-[8-[4-carboxy-3-(trifluoromethyl)phenyl]-10-(2-morpholin-4-ylethyl)phenoxazin-2-yl]-2-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc3c(c2)N(CCN2CCOCC2)c2cc(-c4ccc(C(=O)O)c(C(F)(F)F)c4)ccc2O3)cc1C(F)(F)F |
| InChI | InChI=1S/C34H26F6N2O6/c35-33(36,37)25-15-19(1-5-23(25)31(43)44)21-3-7-29-27(17-21)42(10-9-41-11-13-47-14-12-41)28-18-22(4-8-30(28)48-29)20-2-6-24(32(45)46)26(16-20)34(38,39)40/h1-8,15-18H,9-14H2,(H,43,44)(H,45,46) |
| InChIKey | VMEFOIGELUNOMT-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.58 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'} |
|---|