C21H14F3N3O — CID 59863067
4-[5-[4-phenyl-3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]aniline (PubChem CID 59863067) has the molecular formula C21H14F3N3O and a molecular weight of 381.36 g/mol. Its IUPAC name is 4-[5-[4-phenyl-3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]aniline.
| Compound Name | 4-[5-[4-phenyl-3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]aniline |
|---|---|
| PubChem CID | 59863067 |
| Molecular Formula | C21H14F3N3O |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 4-[5-[4-phenyl-3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]aniline |
| SMILES | Nc1ccc(-c2nnc(-c3ccc(-c4ccccc4)c(C(F)(F)F)c3)o2)cc1 |
| InChI | InChI=1S/C21H14F3N3O/c22-21(23,24)18-12-15(8-11-17(18)13-4-2-1-3-5-13)20-27-26-19(28-20)14-6-9-16(25)10-7-14/h1-12H,25H2 |
| InChIKey | WRZJPQXPRDEQNQ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|