C25H23F3N4O — CID 170665230
2-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-5-[4-(1,2,3,6-tetrahydropyridin-4-yl)-2-(trifluoromethyl)phenyl]-1,3,4-oxadiazole (PubChem CID 170665230) has the molecular formula C25H23F3N4O and a molecular weight of 452.48 g/mol. Its IUPAC name is 2-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-5-[4-(1,2,3,6-tetrahydropyridin-4-yl)-2-(trifluoromethyl)phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-5-[4-(1,2,3,6-tetrahydropyridin-4-yl)-2-(trifluoromethyl)phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 170665230 |
| Molecular Formula | C25H23F3N4O |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 2-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-5-[4-(1,2,3,6-tetrahydropyridin-4-yl)-2-(trifluoromethyl)phenyl]-1,3,4-oxadiazole |
| SMILES | FC(F)(F)c1cc(C2=CCNCC2)ccc1-c1nnc(-c2ccc(C3=CCNCC3)cc2)o1 |
| InChI | InChI=1S/C25H23F3N4O/c26-25(27,28)22-15-20(18-9-13-30-14-10-18)5-6-21(22)24-32-31-23(33-24)19-3-1-16(2-4-19)17-7-11-29-12-8-17/h1-7,9,15,29-30H,8,10-14H2 |
| InChIKey | YGIJKXGACBLTPU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |