About 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;(4-aminophenyl)-phenylmethanone
4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;(4-aminophenyl)-phenylmethanone (PubChem CID 167533534) has the molecular formula C27H23N5O2
and a molecular weight of 449.51 g/mol. Its IUPAC name is 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;(4-aminophenyl)-phenylmethanone.
Molecular Properties
| Compound Name | 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;(4-aminophenyl)-phenylmethanone |
| PubChem CID | 167533534 |
| Molecular Formula | C27H23N5O2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;(4-aminophenyl)-phenylmethanone |
| SMILES | Nc1ccc(-c2nnc(-c3ccc(N)cc3)o2)cc1.Nc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C14H12N4O.C13H11NO/c15-11-5-1-9(2-6-11)13-17-18-14(19-13)10-3-7-12(16)8-4-10;14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-8H,15-16H2;1-9H,14H2 |
| InChIKey | AGZHORUWEUHOHD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 134.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;(4-aminophenyl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;(4-aminophenyl)-phenylmethanone?
The IUPAC name of 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;(4-aminophenyl)-phenylmethanone (CID 167533534) is 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;(4-aminophenyl)-phenylmethanone.
What is the SMILES notation for 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;(4-aminophenyl)-phenylmethanone?
The canonical SMILES for 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;(4-aminophenyl)-phenylmethanone is Nc1ccc(-c2nnc(-c3ccc(N)cc3)o2)cc1.Nc1ccc(C(=O)c2ccccc2)cc1.
What is the InChIKey of 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;(4-aminophenyl)-phenylmethanone?
The InChIKey is AGZHORUWEUHOHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O.C13H11NO/c15-11-5-1-9(2-6-11)13-17-18-14(19-13)10-3-7-12(16)8-4-10;14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-8H,15-16H2;1-9H,14H2.
What are the key properties of 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;(4-aminophenyl)-phenylmethanone?
4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;(4-aminophenyl)-phenylmethanone has a molecular weight of 449.51 g/mol, XLogP of 5.07, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;(4-aminophenyl)-phenylmethanone is sourced from PubChem (CID 167533534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).