C27H23N5O2 — CID 167533534
4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;(4-aminophenyl)-phenylmethanone (PubChem CID 167533534) has the molecular formula C27H23N5O2 and a molecular weight of 449.51 g/mol. Its IUPAC name is 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;(4-aminophenyl)-phenylmethanone.
| Compound Name | 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;(4-aminophenyl)-phenylmethanone |
|---|---|
| PubChem CID | 167533534 |
| Molecular Formula | C27H23N5O2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;(4-aminophenyl)-phenylmethanone |
| SMILES | Nc1ccc(-c2nnc(-c3ccc(N)cc3)o2)cc1.Nc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C14H12N4O.C13H11NO/c15-11-5-1-9(2-6-11)13-17-18-14(19-13)10-3-7-12(16)8-4-10;14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-8H,15-16H2;1-9H,14H2 |
| InChIKey | AGZHORUWEUHOHD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 134.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|