C21H13F9N2O4S2 — CID 148946042
4-[4-[4-amino-3-(trifluoromethyl)phenyl]sulfonyl-3-(trifluoromethyl)phenyl]sulfonyl-3-(trifluoromethyl)aniline (PubChem CID 148946042) has the molecular formula C21H13F9N2O4S2 and a molecular weight of 592.46 g/mol. Its IUPAC name is 4-[4-[4-amino-3-(trifluoromethyl)phenyl]sulfonyl-3-(trifluoromethyl)phenyl]sulfonyl-3-(trifluoromethyl)aniline.
| Compound Name | 4-[4-[4-amino-3-(trifluoromethyl)phenyl]sulfonyl-3-(trifluoromethyl)phenyl]sulfonyl-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 148946042 |
| Molecular Formula | C21H13F9N2O4S2 |
| Molecular Weight | 592.46 g/mol |
| Exact Mass | 592.02 |
| IUPAC Name | 4-[4-[4-amino-3-(trifluoromethyl)phenyl]sulfonyl-3-(trifluoromethyl)phenyl]sulfonyl-3-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(S(=O)(=O)c2ccc(S(=O)(=O)c3ccc(N)c(C(F)(F)F)c3)c(C(F)(F)F)c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H13F9N2O4S2/c22-19(23,24)13-8-11(2-4-16(13)32)37(33,34)18-6-3-12(9-15(18)21(28,29)30)38(35,36)17-5-1-10(31)7-14(17)20(25,26)27/h1-9H,31-32H2 |
| InChIKey | POYMUMHQLYAPCX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.46 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|