C23H23F3N2O2S — CID 57113925
4-[2-[ethyl(2-phenylethyl)amino]phenyl]sulfonyl-2-(trifluoromethyl)aniline (PubChem CID 57113925) has the molecular formula C23H23F3N2O2S and a molecular weight of 448.51 g/mol. Its IUPAC name is 4-[2-[ethyl(2-phenylethyl)amino]phenyl]sulfonyl-2-(trifluoromethyl)aniline.
| Compound Name | 4-[2-[ethyl(2-phenylethyl)amino]phenyl]sulfonyl-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 57113925 |
| Molecular Formula | C23H23F3N2O2S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 4-[2-[ethyl(2-phenylethyl)amino]phenyl]sulfonyl-2-(trifluoromethyl)aniline |
| SMILES | CCN(CCc1ccccc1)c1ccccc1S(=O)(=O)c1ccc(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H23F3N2O2S/c1-2-28(15-14-17-8-4-3-5-9-17)21-10-6-7-11-22(21)31(29,30)18-12-13-20(27)19(16-18)23(24,25)26/h3-13,16H,2,14-15,27H2,1H3 |
| InChIKey | MZOATKZHJUPZHV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|