C21H15F3N2O5S2 — CID 57182900
4-[4-amino-3-(trifluoromethyl)phenyl]sulfonyl-2-phenyl-1H-indole-3-sulfonic acid (PubChem CID 57182900) has the molecular formula C21H15F3N2O5S2 and a molecular weight of 496.49 g/mol. Its IUPAC name is 4-[4-amino-3-(trifluoromethyl)phenyl]sulfonyl-2-phenyl-1H-indole-3-sulfonic acid.
| Compound Name | 4-[4-amino-3-(trifluoromethyl)phenyl]sulfonyl-2-phenyl-1H-indole-3-sulfonic acid |
|---|---|
| PubChem CID | 57182900 |
| Molecular Formula | C21H15F3N2O5S2 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | 4-[4-amino-3-(trifluoromethyl)phenyl]sulfonyl-2-phenyl-1H-indole-3-sulfonic acid |
| SMILES | Nc1ccc(S(=O)(=O)c2cccc3[nH]c(-c4ccccc4)c(S(=O)(=O)O)c23)cc1C(F)(F)F |
| InChI | InChI=1S/C21H15F3N2O5S2/c22-21(23,24)14-11-13(9-10-15(14)25)32(27,28)17-8-4-7-16-18(17)20(33(29,30)31)19(26-16)12-5-2-1-3-6-12/h1-11,26H,25H2,(H,29,30,31) |
| InChIKey | VMDFKYTYMDDENH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 130.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|