C18H23ClN2O2S — CID 56990220
2-chloro-4-[2-(dipropylamino)phenyl]sulfonylaniline (PubChem CID 56990220) has the molecular formula C18H23ClN2O2S and a molecular weight of 366.91 g/mol. Its IUPAC name is 2-chloro-4-[2-(dipropylamino)phenyl]sulfonylaniline.
| Compound Name | 2-chloro-4-[2-(dipropylamino)phenyl]sulfonylaniline |
|---|---|
| PubChem CID | 56990220 |
| Molecular Formula | C18H23ClN2O2S |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-chloro-4-[2-(dipropylamino)phenyl]sulfonylaniline |
| SMILES | CCCN(CCC)c1ccccc1S(=O)(=O)c1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C18H23ClN2O2S/c1-3-11-21(12-4-2)17-7-5-6-8-18(17)24(22,23)14-9-10-16(20)15(19)13-14/h5-10,13H,3-4,11-12,20H2,1-2H3 |
| InChIKey | DWFHQPDBJLRBMR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|