C13H23N3O2S — CID 82899326
4-amino-3-[ethyl(propyl)amino]-N,N-dimethylbenzenesulfonamide (PubChem CID 82899326) has the molecular formula C13H23N3O2S and a molecular weight of 285.41 g/mol. Its IUPAC name is 4-amino-3-[ethyl(propyl)amino]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-amino-3-[ethyl(propyl)amino]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 82899326 |
| Molecular Formula | C13H23N3O2S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 4-amino-3-[ethyl(propyl)amino]-N,N-dimethylbenzenesulfonamide |
| SMILES | CCCN(CC)c1cc(S(=O)(=O)N(C)C)ccc1N |
| InChI | InChI=1S/C13H23N3O2S/c1-5-9-16(6-2)13-10-11(7-8-12(13)14)19(17,18)15(3)4/h7-8,10H,5-6,9,14H2,1-4H3 |
| InChIKey | OBWCEFIXCRFVJX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|