About 3-N-ethenyl-3-N-[(methyl-λ3-iodanylidene)methyl]-5-(trifluoromethyl)benzene-1,3-diamine
3-N-ethenyl-3-N-[(methyl-λ3-iodanylidene)methyl]-5-(trifluoromethyl)benzene-1,3-diamine (PubChem CID 163468423) has the molecular formula C11H12F3IN2
and a molecular weight of 356.13 g/mol. Its IUPAC name is 3-N-ethenyl-3-N-[(methyl-λ3-iodanylidene)methyl]-5-(trifluoromethyl)benzene-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-ethenyl-3-N-[(methyl-λ3-iodanylidene)methyl]-5-(trifluoromethyl)benzene-1,3-diamine |
| PubChem CID | 163468423 |
| Molecular Formula | C11H12F3IN2 |
| Molecular Weight | 356.13 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 3-N-ethenyl-3-N-[(methyl-λ3-iodanylidene)methyl]-5-(trifluoromethyl)benzene-1,3-diamine |
| SMILES | C=CN(/C=I/C)c1cc(N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F3IN2/c1-3-17(7-15-2)10-5-8(11(12,13)14)4-9(16)6-10/h3-7H,1,16H2,2H3 |
| InChIKey | BUOQCIYNFSRNPW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.13 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-N-ethenyl-3-N-[(methyl-λ3-iodanylidene)methyl]-5-(trifluoromethyl)benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-ethenyl-3-N-[(methyl-λ3-iodanylidene)methyl]-5-(trifluoromethyl)benzene-1,3-diamine?
The IUPAC name of 3-N-ethenyl-3-N-[(methyl-λ3-iodanylidene)methyl]-5-(trifluoromethyl)benzene-1,3-diamine (CID 163468423) is 3-N-ethenyl-3-N-[(methyl-λ3-iodanylidene)methyl]-5-(trifluoromethyl)benzene-1,3-diamine.
What is the SMILES notation for 3-N-ethenyl-3-N-[(methyl-λ3-iodanylidene)methyl]-5-(trifluoromethyl)benzene-1,3-diamine?
The canonical SMILES for 3-N-ethenyl-3-N-[(methyl-λ3-iodanylidene)methyl]-5-(trifluoromethyl)benzene-1,3-diamine is C=CN(/C=I/C)c1cc(N)cc(C(F)(F)F)c1.
What is the InChIKey of 3-N-ethenyl-3-N-[(methyl-λ3-iodanylidene)methyl]-5-(trifluoromethyl)benzene-1,3-diamine?
The InChIKey is BUOQCIYNFSRNPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3IN2/c1-3-17(7-15-2)10-5-8(11(12,13)14)4-9(16)6-10/h3-7H,1,16H2,2H3.
What are the key properties of 3-N-ethenyl-3-N-[(methyl-λ3-iodanylidene)methyl]-5-(trifluoromethyl)benzene-1,3-diamine?
3-N-ethenyl-3-N-[(methyl-λ3-iodanylidene)methyl]-5-(trifluoromethyl)benzene-1,3-diamine has a molecular weight of 356.13 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-ethenyl-3-N-[(methyl-λ3-iodanylidene)methyl]-5-(trifluoromethyl)benzene-1,3-diamine is sourced from PubChem (CID 163468423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).