C12H15F3N2O2 — CID 134408954
1-[3-amino-N-methyl-5-(trifluoromethyl)anilino]propan-2-yl formate (PubChem CID 134408954) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 1-[3-amino-N-methyl-5-(trifluoromethyl)anilino]propan-2-yl formate.
| Compound Name | 1-[3-amino-N-methyl-5-(trifluoromethyl)anilino]propan-2-yl formate |
|---|---|
| PubChem CID | 134408954 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-[3-amino-N-methyl-5-(trifluoromethyl)anilino]propan-2-yl formate |
| SMILES | CC(CN(C)c1cc(N)cc(C(F)(F)F)c1)OC=O |
| InChI | InChI=1S/C12H15F3N2O2/c1-8(19-7-18)6-17(2)11-4-9(12(13,14)15)3-10(16)5-11/h3-5,7-8H,6,16H2,1-2H3 |
| InChIKey | SAVSCMYLKRTPME-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|