C52H40F24N4 — CID 139132044
N-[2-[3-[2-[3,5-bis(trifluoromethyl)anilino]ethyl]phenyl]ethyl]-3,5-bis(trifluoromethyl)aniline (PubChem CID 139132044) has the molecular formula C52H40F24N4 and a molecular weight of 1176.87 g/mol. Its IUPAC name is N-[2-[3-[2-[3,5-bis(trifluoromethyl)anilino]ethyl]phenyl]ethyl]-3,5-bis(trifluoromethyl)aniline.
| Compound Name | N-[2-[3-[2-[3,5-bis(trifluoromethyl)anilino]ethyl]phenyl]ethyl]-3,5-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 139132044 |
| Molecular Formula | C52H40F24N4 |
| Molecular Weight | 1176.87 g/mol |
| Exact Mass | 1176.29 |
| IUPAC Name | N-[2-[3-[2-[3,5-bis(trifluoromethyl)anilino]ethyl]phenyl]ethyl]-3,5-bis(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cc(NCCc2cccc(CCNc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2)cc(C(F)(F)F)c1.FC(F)(F)c1cc(NCCc2cccc(CCNc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/2C26H20F12N2/c2*27-23(28,29)17-9-18(24(30,31)32)12-21(11-17)39-6-4-15-2-1-3-16(8-15)5-7-40-22-13-19(25(33,34)35)10-20(14-22)26(36,37)38/h2*1-3,8-14,39-40H,4-7H2 |
| InChIKey | LBGWPNYZROZMSR-UHFFFAOYSA-N |
| XLogP | 18.14 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1176.87 |
| LogP ≤ 5 | 18.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |