C11H7F6N5O — CID 135521180
6-amino-4-[3,5-bis(trifluoromethyl)anilino]-1H-1,3,5-triazin-2-one (PubChem CID 135521180) has the molecular formula C11H7F6N5O and a molecular weight of 339.20 g/mol. Its IUPAC name is 6-amino-4-[3,5-bis(trifluoromethyl)anilino]-1H-1,3,5-triazin-2-one.
| Compound Name | 6-amino-4-[3,5-bis(trifluoromethyl)anilino]-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 135521180 |
| Molecular Formula | C11H7F6N5O |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 6-amino-4-[3,5-bis(trifluoromethyl)anilino]-1H-1,3,5-triazin-2-one |
| SMILES | Nc1nc(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)nc(=O)[nH]1 |
| InChI | InChI=1S/C11H7F6N5O/c12-10(13,14)4-1-5(11(15,16)17)3-6(2-4)19-8-20-7(18)21-9(23)22-8/h1-3H,(H4,18,19,20,21,22,23) |
| InChIKey | NYYTZZXSBLGIEV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |