About N-[3,5-bis(trifluoromethyl)phenyl]-5-cyclobutyl-1H-pyrazol-3-amine
N-[3,5-bis(trifluoromethyl)phenyl]-5-cyclobutyl-1H-pyrazol-3-amine (PubChem CID 10154812) has the molecular formula C15H13F6N3
and a molecular weight of 349.28 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-5-cyclobutyl-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-5-cyclobutyl-1H-pyrazol-3-amine |
| PubChem CID | 10154812 |
| Molecular Formula | C15H13F6N3 |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-5-cyclobutyl-1H-pyrazol-3-amine |
| SMILES | FC(F)(F)c1cc(Nc2cc(C3CCC3)[nH]n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H13F6N3/c16-14(17,18)9-4-10(15(19,20)21)6-11(5-9)22-13-7-12(23-24-13)8-2-1-3-8/h4-8H,1-3H2,(H2,22,23,24) |
| InChIKey | QVDBUAZHHAMIOE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3,5-bis(trifluoromethyl)phenyl]-5-cyclobutyl-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-5-cyclobutyl-1H-pyrazol-3-amine?
The IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-5-cyclobutyl-1H-pyrazol-3-amine (CID 10154812) is N-[3,5-bis(trifluoromethyl)phenyl]-5-cyclobutyl-1H-pyrazol-3-amine.
What is the SMILES notation for N-[3,5-bis(trifluoromethyl)phenyl]-5-cyclobutyl-1H-pyrazol-3-amine?
The canonical SMILES for N-[3,5-bis(trifluoromethyl)phenyl]-5-cyclobutyl-1H-pyrazol-3-amine is FC(F)(F)c1cc(Nc2cc(C3CCC3)[nH]n2)cc(C(F)(F)F)c1.
What is the InChIKey of N-[3,5-bis(trifluoromethyl)phenyl]-5-cyclobutyl-1H-pyrazol-3-amine?
The InChIKey is QVDBUAZHHAMIOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F6N3/c16-14(17,18)9-4-10(15(19,20)21)6-11(5-9)22-13-7-12(23-24-13)8-2-1-3-8/h4-8H,1-3H2,(H2,22,23,24).
What are the key properties of N-[3,5-bis(trifluoromethyl)phenyl]-5-cyclobutyl-1H-pyrazol-3-amine?
N-[3,5-bis(trifluoromethyl)phenyl]-5-cyclobutyl-1H-pyrazol-3-amine has a molecular weight of 349.28 g/mol, XLogP of 5.46, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-bis(trifluoromethyl)phenyl]-5-cyclobutyl-1H-pyrazol-3-amine is sourced from PubChem (CID 10154812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).