C15H8BrF7N2O — CID 16755222
1-[4-bromo-3-(trifluoromethyl)phenyl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea (PubChem CID 16755222) has the molecular formula C15H8BrF7N2O and a molecular weight of 445.13 g/mol. Its IUPAC name is 1-[4-bromo-3-(trifluoromethyl)phenyl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-bromo-3-(trifluoromethyl)phenyl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 16755222 |
| Molecular Formula | C15H8BrF7N2O |
| Molecular Weight | 445.13 g/mol |
| Exact Mass | 443.97 |
| IUPAC Name | 1-[4-bromo-3-(trifluoromethyl)phenyl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cc(F)cc(C(F)(F)F)c1)Nc1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H8BrF7N2O/c16-12-2-1-9(6-11(12)15(21,22)23)24-13(26)25-10-4-7(14(18,19)20)3-8(17)5-10/h1-6H,(H2,24,25,26) |
| InChIKey | ITXASAQHCNOOSN-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.13 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |