C13H13BrF3NOS — CID 107031027
N-[4-bromo-3-(trifluoromethyl)phenyl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide (PubChem CID 107031027) has the molecular formula C13H13BrF3NOS and a molecular weight of 368.22 g/mol. Its IUPAC name is N-[4-bromo-3-(trifluoromethyl)phenyl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide.
| Compound Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide |
|---|---|
| PubChem CID | 107031027 |
| Molecular Formula | C13H13BrF3NOS |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide |
| SMILES | O=C(CC1(CS)CC1)Nc1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13BrF3NOS/c14-10-2-1-8(5-9(10)13(15,16)17)18-11(19)6-12(7-20)3-4-12/h1-2,5,20H,3-4,6-7H2,(H,18,19) |
| InChIKey | RCOIEVRMEUSDIQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|