C15H13ClFNOS — CID 64794262
4-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]-2-fluorophenol (PubChem CID 64794262) has the molecular formula C15H13ClFNOS and a molecular weight of 309.79 g/mol. Its IUPAC name is 4-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]-2-fluorophenol.
| Compound Name | 4-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]-2-fluorophenol |
|---|---|
| PubChem CID | 64794262 |
| Molecular Formula | C15H13ClFNOS |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 4-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]-2-fluorophenol |
| SMILES | Oc1ccc(NC2CCSc3ccc(Cl)cc32)cc1F |
| InChI | InChI=1S/C15H13ClFNOS/c16-9-1-4-15-11(7-9)13(5-6-20-15)18-10-2-3-14(19)12(17)8-10/h1-4,7-8,13,18-19H,5-6H2 |
| InChIKey | FZUSXGSUUNHSLJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|