C17H18N2S2 — CID 7567425
1-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-3-(3-methylphenyl)thiourea (PubChem CID 7567425) has the molecular formula C17H18N2S2 and a molecular weight of 314.48 g/mol. Its IUPAC name is 1-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-3-(3-methylphenyl)thiourea.
| Compound Name | 1-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-3-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 7567425 |
| Molecular Formula | C17H18N2S2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-3-(3-methylphenyl)thiourea |
| SMILES | Cc1cccc(NC(=S)N[C@H]2CCSc3ccccc32)c1 |
| InChI | InChI=1S/C17H18N2S2/c1-12-5-4-6-13(11-12)18-17(20)19-15-9-10-21-16-8-3-2-7-14(15)16/h2-8,11,15H,9-10H2,1H3,(H2,18,19,20)/t15-/m0/s1 |
| InChIKey | YTLJAXHEKBPJQN-HNNXBMFYSA-N |
| XLogP | 4.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|