C17H16BrNOS — CID 80958800
2-bromo-N-(3,4-dihydro-2H-thiochromen-4-yl)-5-methylbenzamide (PubChem CID 80958800) has the molecular formula C17H16BrNOS and a molecular weight of 362.29 g/mol. Its IUPAC name is 2-bromo-N-(3,4-dihydro-2H-thiochromen-4-yl)-5-methylbenzamide.
| Compound Name | 2-bromo-N-(3,4-dihydro-2H-thiochromen-4-yl)-5-methylbenzamide |
|---|---|
| PubChem CID | 80958800 |
| Molecular Formula | C17H16BrNOS |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 2-bromo-N-(3,4-dihydro-2H-thiochromen-4-yl)-5-methylbenzamide |
| SMILES | Cc1ccc(Br)c(C(=O)NC2CCSc3ccccc32)c1 |
| InChI | InChI=1S/C17H16BrNOS/c1-11-6-7-14(18)13(10-11)17(20)19-15-8-9-21-16-5-3-2-4-12(15)16/h2-7,10,15H,8-9H2,1H3,(H,19,20) |
| InChIKey | GZBYOPZRWAAHJH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |