C15H14N2O2S — CID 103336899
N-(3,4-dihydro-2H-thiochromen-4-yl)-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 103336899) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-thiochromen-4-yl)-4-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(3,4-dihydro-2H-thiochromen-4-yl)-4-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103336899 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | N-(3,4-dihydro-2H-thiochromen-4-yl)-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(NC1CCSc2ccccc21)c1c[nH]ccc1=O |
| InChI | InChI=1S/C15H14N2O2S/c18-13-5-7-16-9-11(13)15(19)17-12-6-8-20-14-4-2-1-3-10(12)14/h1-5,7,9,12H,6,8H2,(H,16,18)(H,17,19) |
| InChIKey | NKPBAHQXOBXVSZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |