C11H14N2O2S — CID 106741440
4-oxo-N-(thian-4-yl)-1H-pyridine-3-carboxamide (PubChem CID 106741440) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 4-oxo-N-(thian-4-yl)-1H-pyridine-3-carboxamide.
| Compound Name | 4-oxo-N-(thian-4-yl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 106741440 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 4-oxo-N-(thian-4-yl)-1H-pyridine-3-carboxamide |
| SMILES | O=C(NC1CCSCC1)c1c[nH]ccc1=O |
| InChI | InChI=1S/C11H14N2O2S/c14-10-1-4-12-7-9(10)11(15)13-8-2-5-16-6-3-8/h1,4,7-8H,2-3,5-6H2,(H,12,14)(H,13,15) |
| InChIKey | RXLGBHQRSWEDSX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |