C12H14N2O4 — CID 114038732
3-cyclopropyl-3-[(4-oxo-1H-pyridine-3-carbonyl)amino]propanoic acid (PubChem CID 114038732) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 3-cyclopropyl-3-[(4-oxo-1H-pyridine-3-carbonyl)amino]propanoic acid.
| Compound Name | 3-cyclopropyl-3-[(4-oxo-1H-pyridine-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 114038732 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 3-cyclopropyl-3-[(4-oxo-1H-pyridine-3-carbonyl)amino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)c1c[nH]ccc1=O)C1CC1 |
| InChI | InChI=1S/C12H14N2O4/c15-10-3-4-13-6-8(10)12(18)14-9(5-11(16)17)7-1-2-7/h3-4,6-7,9H,1-2,5H2,(H,13,15)(H,14,18)(H,16,17) |
| InChIKey | LEVAXQYEZZIKHI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |