C16H14INOS — CID 51173241
N-(3,4-dihydro-2H-thiochromen-4-yl)-2-iodobenzamide (PubChem CID 51173241) has the molecular formula C16H14INOS and a molecular weight of 395.27 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-thiochromen-4-yl)-2-iodobenzamide.
| Compound Name | N-(3,4-dihydro-2H-thiochromen-4-yl)-2-iodobenzamide |
|---|---|
| PubChem CID | 51173241 |
| Molecular Formula | C16H14INOS |
| Molecular Weight | 395.27 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | N-(3,4-dihydro-2H-thiochromen-4-yl)-2-iodobenzamide |
| SMILES | O=C(NC1CCSc2ccccc21)c1ccccc1I |
| InChI | InChI=1S/C16H14INOS/c17-13-7-3-1-5-11(13)16(19)18-14-9-10-20-15-8-4-2-6-12(14)15/h1-8,14H,9-10H2,(H,18,19) |
| InChIKey | ZVFNXTUQQVKPRJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|