C17H17N3O3S — CID 112839983
1-(3,4-dihydro-2H-thiochromen-4-yl)-3-(3-methyl-4-nitrophenyl)urea (PubChem CID 112839983) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-thiochromen-4-yl)-3-(3-methyl-4-nitrophenyl)urea.
| Compound Name | 1-(3,4-dihydro-2H-thiochromen-4-yl)-3-(3-methyl-4-nitrophenyl)urea |
|---|---|
| PubChem CID | 112839983 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 1-(3,4-dihydro-2H-thiochromen-4-yl)-3-(3-methyl-4-nitrophenyl)urea |
| SMILES | Cc1cc(NC(=O)NC2CCSc3ccccc32)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17N3O3S/c1-11-10-12(6-7-15(11)20(22)23)18-17(21)19-14-8-9-24-16-5-3-2-4-13(14)16/h2-7,10,14H,8-9H2,1H3,(H2,18,19,21) |
| InChIKey | HWOAJHYMLMQGLL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|