C15H20N2OS2 — CID 7577053
1-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 7577053) has the molecular formula C15H20N2OS2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 1-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 7577053 |
| Molecular Formula | C15H20N2OS2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | S=C(NC[C@H]1CCCO1)N[C@@H]1CCSc2ccccc21 |
| InChI | InChI=1S/C15H20N2OS2/c19-15(16-10-11-4-3-8-18-11)17-13-7-9-20-14-6-2-1-5-12(13)14/h1-2,5-6,11,13H,3-4,7-10H2,(H2,16,17,19)/t11-,13-/m1/s1 |
| InChIKey | UUXNXNJKJNZSNM-DGCLKSJQSA-N |
| XLogP | 2.87 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|