C14H18N2 — CID 106220652
3-N-pent-4-ynyl-2,3-dihydro-1H-indene-1,3-diamine (PubChem CID 106220652) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 3-N-pent-4-ynyl-2,3-dihydro-1H-indene-1,3-diamine.
| Compound Name | 3-N-pent-4-ynyl-2,3-dihydro-1H-indene-1,3-diamine |
|---|---|
| PubChem CID | 106220652 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 3-N-pent-4-ynyl-2,3-dihydro-1H-indene-1,3-diamine |
| SMILES | C#CCCCNC1CC(N)c2ccccc21 |
| InChI | InChI=1S/C14H18N2/c1-2-3-6-9-16-14-10-13(15)11-7-4-5-8-12(11)14/h1,4-5,7-8,13-14,16H,3,6,9-10,15H2 |
| InChIKey | CXHNHPKXADSPDA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|