C13H15NO2S — CID 114160013
1,1-dioxo-N-pent-4-ynyl-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 114160013) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is 1,1-dioxo-N-pent-4-ynyl-2,3-dihydro-1-benzothiophen-3-amine.
| Compound Name | 1,1-dioxo-N-pent-4-ynyl-2,3-dihydro-1-benzothiophen-3-amine |
|---|---|
| PubChem CID | 114160013 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 1,1-dioxo-N-pent-4-ynyl-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | C#CCCCNC1CS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C13H15NO2S/c1-2-3-6-9-14-12-10-17(15,16)13-8-5-4-7-11(12)13/h1,4-5,7-8,12,14H,3,6,9-10H2 |
| InChIKey | ONQDUASJALOATJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|